2-(5-heptyl-1,3,4-oxadiazol-2-yl)benzoic acid

C16H20N2O3 — CID 81436105

IUPAC2-(5-heptyl-1,3,4-oxadiazol-2-yl)benzoic acid
SMILESCCCCCCCc1nnc(-c2ccccc2C(=O)O)o1
InChIInChI=1S/C16H20N2O3/c1-2-3-4-5-6-11-14-17-18-15(21-14)12-9-7-8-10-13(12)16(19)20/h7-10H,2-6,11H2,1H3,(H,19,20)
InChIKeyBMGKGPMHXJYVGO-UHFFFAOYSA-N
MW288.35 g/mol
LogP3.95
Rot. Bonds8

About 2-(5-heptyl-1,3,4-oxadiazol-2-yl)benzoic acid

2-(5-heptyl-1,3,4-oxadiazol-2-yl)benzoic acid (PubChem CID 81436105) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is 2-(5-heptyl-1,3,4-oxadiazol-2-yl)benzoic acid.

Molecular Properties

Compound Name2-(5-heptyl-1,3,4-oxadiazol-2-yl)benzoic acid
PubChem CID81436105
Molecular FormulaC16H20N2O3
Molecular Weight288.35 g/mol
Exact Mass288.15
IUPAC Name2-(5-heptyl-1,3,4-oxadiazol-2-yl)benzoic acid
SMILESCCCCCCCc1nnc(-c2ccccc2C(=O)O)o1
InChIInChI=1S/C16H20N2O3/c1-2-3-4-5-6-11-14-17-18-15(21-14)12-9-7-8-10-13(12)16(19)20/h7-10H,2-6,11H2,1H3,(H,19,20)
InChIKeyBMGKGPMHXJYVGO-UHFFFAOYSA-N
XLogP3.95
TPSA76.22 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds8
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500288.35
LogP ≤ 53.95
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2-(5-heptyl-1,3,4-oxadiazol-2-yl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(5-heptyl-1,3,4-oxadiazol-2-yl)benzoic acid?
The IUPAC name of 2-(5-heptyl-1,3,4-oxadiazol-2-yl)benzoic acid (CID 81436105) is 2-(5-heptyl-1,3,4-oxadiazol-2-yl)benzoic acid.
What is the SMILES notation for 2-(5-heptyl-1,3,4-oxadiazol-2-yl)benzoic acid?
The canonical SMILES for 2-(5-heptyl-1,3,4-oxadiazol-2-yl)benzoic acid is CCCCCCCc1nnc(-c2ccccc2C(=O)O)o1.
What is the InChIKey of 2-(5-heptyl-1,3,4-oxadiazol-2-yl)benzoic acid?
The InChIKey is BMGKGPMHXJYVGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20N2O3/c1-2-3-4-5-6-11-14-17-18-15(21-14)12-9-7-8-10-13(12)16(19)20/h7-10H,2-6,11H2,1H3,(H,19,20).
What are the key properties of 2-(5-heptyl-1,3,4-oxadiazol-2-yl)benzoic acid?
2-(5-heptyl-1,3,4-oxadiazol-2-yl)benzoic acid has a molecular weight of 288.35 g/mol, XLogP of 3.95, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-heptyl-1,3,4-oxadiazol-2-yl)benzoic acid is sourced from PubChem (CID 81436105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).