C20H27N3O4S — CID 135838386
2-methyl-3-(5-nonyl-1,3,4-oxadiazol-2-yl)-1,1-dioxo-1λ6,2-benzothiazin-4-ol (PubChem CID 135838386) has the molecular formula C20H27N3O4S and a molecular weight of 405.52 g/mol. Its IUPAC name is 2-methyl-3-(5-nonyl-1,3,4-oxadiazol-2-yl)-1,1-dioxo-1λ6,2-benzothiazin-4-ol.
| Compound Name | 2-methyl-3-(5-nonyl-1,3,4-oxadiazol-2-yl)-1,1-dioxo-1λ6,2-benzothiazin-4-ol |
|---|---|
| PubChem CID | 135838386 |
| Molecular Formula | C20H27N3O4S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | 2-methyl-3-(5-nonyl-1,3,4-oxadiazol-2-yl)-1,1-dioxo-1λ6,2-benzothiazin-4-ol |
| SMILES | CCCCCCCCCc1nnc(C2=C(O)c3ccccc3S(=O)(=O)N2C)o1 |
| InChI | InChI=1S/C20H27N3O4S/c1-3-4-5-6-7-8-9-14-17-21-22-20(27-17)18-19(24)15-12-10-11-13-16(15)28(25,26)23(18)2/h10-13,24H,3-9,14H2,1-2H3 |
| InChIKey | DHFIZADYOTYASZ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|