C21H21Cl2N3O3 — CID 22054979
1-[5-[3-(3,5-dichlorophenyl)phenoxy]-2-hydroxypentyl]imidazole-4-carboxamide (PubChem CID 22054979) has the molecular formula C21H21Cl2N3O3 and a molecular weight of 434.32 g/mol. Its IUPAC name is 1-[5-[3-(3,5-dichlorophenyl)phenoxy]-2-hydroxypentyl]imidazole-4-carboxamide.
| Compound Name | 1-[5-[3-(3,5-dichlorophenyl)phenoxy]-2-hydroxypentyl]imidazole-4-carboxamide |
|---|---|
| PubChem CID | 22054979 |
| Molecular Formula | C21H21Cl2N3O3 |
| Molecular Weight | 434.32 g/mol |
| Exact Mass | 433.10 |
| IUPAC Name | 1-[5-[3-(3,5-dichlorophenyl)phenoxy]-2-hydroxypentyl]imidazole-4-carboxamide |
| SMILES | NC(=O)c1cn(CC(O)CCCOc2cccc(-c3cc(Cl)cc(Cl)c3)c2)cn1 |
| InChI | InChI=1S/C21H21Cl2N3O3/c22-16-7-15(8-17(23)10-16)14-3-1-5-19(9-14)29-6-2-4-18(27)11-26-12-20(21(24)28)25-13-26/h1,3,5,7-10,12-13,18,27H,2,4,6,11H2,(H2,24,28) |
| InChIKey | GMINSJQVHDJCHJ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.32 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|