C23H27N3O3S — CID 22391673
1-[2-hydroxy-5-[2-[(4-methylsulfanylphenyl)methoxy]phenyl]pentyl]imidazole-4-carboxamide (PubChem CID 22391673) has the molecular formula C23H27N3O3S and a molecular weight of 425.55 g/mol. Its IUPAC name is 1-[2-hydroxy-5-[2-[(4-methylsulfanylphenyl)methoxy]phenyl]pentyl]imidazole-4-carboxamide.
| Compound Name | 1-[2-hydroxy-5-[2-[(4-methylsulfanylphenyl)methoxy]phenyl]pentyl]imidazole-4-carboxamide |
|---|---|
| PubChem CID | 22391673 |
| Molecular Formula | C23H27N3O3S |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.18 |
| IUPAC Name | 1-[2-hydroxy-5-[2-[(4-methylsulfanylphenyl)methoxy]phenyl]pentyl]imidazole-4-carboxamide |
| SMILES | CSc1ccc(COc2ccccc2CCCC(O)Cn2cnc(C(N)=O)c2)cc1 |
| InChI | InChI=1S/C23H27N3O3S/c1-30-20-11-9-17(10-12-20)15-29-22-8-3-2-5-18(22)6-4-7-19(27)13-26-14-21(23(24)28)25-16-26/h2-3,5,8-12,14,16,19,27H,4,6-7,13,15H2,1H3,(H2,24,28) |
| InChIKey | POJWFPYSISWKHI-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |