C26H27N3O3S — CID 22391690
1-[2-hydroxy-5-[2-[(4-thiophen-2-ylphenyl)methoxy]phenyl]pentyl]imidazole-4-carboxamide (PubChem CID 22391690) has the molecular formula C26H27N3O3S and a molecular weight of 461.59 g/mol. Its IUPAC name is 1-[2-hydroxy-5-[2-[(4-thiophen-2-ylphenyl)methoxy]phenyl]pentyl]imidazole-4-carboxamide.
| Compound Name | 1-[2-hydroxy-5-[2-[(4-thiophen-2-ylphenyl)methoxy]phenyl]pentyl]imidazole-4-carboxamide |
|---|---|
| PubChem CID | 22391690 |
| Molecular Formula | C26H27N3O3S |
| Molecular Weight | 461.59 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | 1-[2-hydroxy-5-[2-[(4-thiophen-2-ylphenyl)methoxy]phenyl]pentyl]imidazole-4-carboxamide |
| SMILES | NC(=O)c1cn(CC(O)CCCc2ccccc2OCc2ccc(-c3cccs3)cc2)cn1 |
| InChI | InChI=1S/C26H27N3O3S/c27-26(31)23-16-29(18-28-23)15-22(30)7-3-6-20-5-1-2-8-24(20)32-17-19-10-12-21(13-11-19)25-9-4-14-33-25/h1-2,4-5,8-14,16,18,22,30H,3,6-7,15,17H2,(H2,27,31) |
| InChIKey | WUDBNRRPCFCSSW-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 90.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.59 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |