C18H14N2O2S — CID 139599198
1-methyl-3-[(2-methyl-1,3-benzothiazol-5-yl)oxy]quinolin-2-one (PubChem CID 139599198) has the molecular formula C18H14N2O2S and a molecular weight of 322.39 g/mol. Its IUPAC name is 1-methyl-3-[(2-methyl-1,3-benzothiazol-5-yl)oxy]quinolin-2-one.
| Compound Name | 1-methyl-3-[(2-methyl-1,3-benzothiazol-5-yl)oxy]quinolin-2-one |
|---|---|
| PubChem CID | 139599198 |
| Molecular Formula | C18H14N2O2S |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | 1-methyl-3-[(2-methyl-1,3-benzothiazol-5-yl)oxy]quinolin-2-one |
| SMILES | Cc1nc2cc(Oc3cc4ccccc4n(C)c3=O)ccc2s1 |
| InChI | InChI=1S/C18H14N2O2S/c1-11-19-14-10-13(7-8-17(14)23-11)22-16-9-12-5-3-4-6-15(12)20(2)18(16)21/h3-10H,1-2H3 |
| InChIKey | JNCFUGMHNWXDIL-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |