C16H14ClNO2S — CID 159157664
4-(5-chloro-1,3-benzothiazol-2-yl)-2-ethoxy-3-methylphenol (PubChem CID 159157664) has the molecular formula C16H14ClNO2S and a molecular weight of 319.81 g/mol. Its IUPAC name is 4-(5-chloro-1,3-benzothiazol-2-yl)-2-ethoxy-3-methylphenol.
| Compound Name | 4-(5-chloro-1,3-benzothiazol-2-yl)-2-ethoxy-3-methylphenol |
|---|---|
| PubChem CID | 159157664 |
| Molecular Formula | C16H14ClNO2S |
| Molecular Weight | 319.81 g/mol |
| Exact Mass | 319.04 |
| IUPAC Name | 4-(5-chloro-1,3-benzothiazol-2-yl)-2-ethoxy-3-methylphenol |
| SMILES | CCOc1c(O)ccc(-c2nc3cc(Cl)ccc3s2)c1C |
| InChI | InChI=1S/C16H14ClNO2S/c1-3-20-15-9(2)11(5-6-13(15)19)16-18-12-8-10(17)4-7-14(12)21-16/h4-8,19H,3H2,1-2H3 |
| InChIKey | KKCBTMFWZDJBPF-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.81 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |