C18H14N2S — CID 43305013
3-(5-methyl-1,3-benzothiazol-2-yl)naphthalen-2-amine (PubChem CID 43305013) has the molecular formula C18H14N2S and a molecular weight of 290.39 g/mol. Its IUPAC name is 3-(5-methyl-1,3-benzothiazol-2-yl)naphthalen-2-amine.
| Compound Name | 3-(5-methyl-1,3-benzothiazol-2-yl)naphthalen-2-amine |
|---|---|
| PubChem CID | 43305013 |
| Molecular Formula | C18H14N2S |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 3-(5-methyl-1,3-benzothiazol-2-yl)naphthalen-2-amine |
| SMILES | Cc1ccc2sc(-c3cc4ccccc4cc3N)nc2c1 |
| InChI | InChI=1S/C18H14N2S/c1-11-6-7-17-16(8-11)20-18(21-17)14-9-12-4-2-3-5-13(12)10-15(14)19/h2-10H,19H2,1H3 |
| InChIKey | FNNUQHRVHAUEGN-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|