C16H19BClN4OS2 — CID 58088066
CID 58088066 (PubChem CID 58088066) has the molecular formula C16H19BClN4OS2 and a molecular weight of 393.75 g/mol.
| Compound Name | CID 58088066 |
|---|---|
| PubChem CID | 58088066 |
| Molecular Formula | C16H19BClN4OS2 |
| Molecular Weight | 393.75 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | — |
| SMILES | [B-][N+]12CCC(CC1)C(O)(CNC(=S)Nc1nc3c(Cl)cccc3s1)C2 |
| InChI | InChI=1S/C16H18BClN4OS2/c17-22-6-4-10(5-7-22)16(23,9-22)8-19-14(24)21-15-20-13-11(18)2-1-3-12(13)25-15/h1-3,10,23H,4-9H2,(H-,19,20,21,24)/q-1/p+1 |
| InChIKey | YFVGRZPJGVRWSQ-UHFFFAOYSA-O |
| XLogP | 2.29 |
| TPSA | 57.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.75 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|