C16H17BClN4OS — CID 58088290
CID 58088290 (PubChem CID 58088290) has the molecular formula C16H17BClN4OS and a molecular weight of 359.67 g/mol.
| Compound Name | CID 58088290 |
|---|---|
| PubChem CID | 58088290 |
| Molecular Formula | C16H17BClN4OS |
| Molecular Weight | 359.67 g/mol |
| Exact Mass | 359.09 |
| IUPAC Name | — |
| SMILES | [B-][N+]12CCC(CC1)C1(CN=C(Nc3nc4c(Cl)cccc4s3)O1)C2 |
| InChI | InChI=1S/C16H17BClN4OS/c17-22-6-4-10(5-7-22)16(9-22)8-19-14(23-16)21-15-20-13-11(18)2-1-3-12(13)24-15/h1-3,10H,4-9H2,(H,19,20,21) |
| InChIKey | NNQXMUWCNPFJTE-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 46.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.67 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|