C19H19BrN2O2S — CID 41235389
N-(4-bromo-1,3-benzothiazol-2-yl)-4-pentoxybenzamide (PubChem CID 41235389) has the molecular formula C19H19BrN2O2S and a molecular weight of 419.34 g/mol. Its IUPAC name is N-(4-bromo-1,3-benzothiazol-2-yl)-4-pentoxybenzamide.
| Compound Name | N-(4-bromo-1,3-benzothiazol-2-yl)-4-pentoxybenzamide |
|---|---|
| PubChem CID | 41235389 |
| Molecular Formula | C19H19BrN2O2S |
| Molecular Weight | 419.34 g/mol |
| Exact Mass | 418.04 |
| IUPAC Name | N-(4-bromo-1,3-benzothiazol-2-yl)-4-pentoxybenzamide |
| SMILES | CCCCCOc1ccc(C(=O)Nc2nc3c(Br)cccc3s2)cc1 |
| InChI | InChI=1S/C19H19BrN2O2S/c1-2-3-4-12-24-14-10-8-13(9-11-14)18(23)22-19-21-17-15(20)6-5-7-16(17)25-19/h5-11H,2-4,12H2,1H3,(H,21,22,23) |
| InChIKey | YLMAIZYNMJNZER-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.34 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|