C23H18FN3O3S2 — CID 22912147
N-benzyl-4-(4-fluorophenyl)-5-(4-sulfamoylphenyl)-1,3-thiazole-2-carboxamide (PubChem CID 22912147) has the molecular formula C23H18FN3O3S2 and a molecular weight of 467.55 g/mol. Its IUPAC name is N-benzyl-4-(4-fluorophenyl)-5-(4-sulfamoylphenyl)-1,3-thiazole-2-carboxamide.
| Compound Name | N-benzyl-4-(4-fluorophenyl)-5-(4-sulfamoylphenyl)-1,3-thiazole-2-carboxamide |
|---|---|
| PubChem CID | 22912147 |
| Molecular Formula | C23H18FN3O3S2 |
| Molecular Weight | 467.55 g/mol |
| Exact Mass | 467.08 |
| IUPAC Name | N-benzyl-4-(4-fluorophenyl)-5-(4-sulfamoylphenyl)-1,3-thiazole-2-carboxamide |
| SMILES | NS(=O)(=O)c1ccc(-c2sc(C(=O)NCc3ccccc3)nc2-c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C23H18FN3O3S2/c24-18-10-6-16(7-11-18)20-21(17-8-12-19(13-9-17)32(25,29)30)31-23(27-20)22(28)26-14-15-4-2-1-3-5-15/h1-13H,14H2,(H,26,28)(H2,25,29,30) |
| InChIKey | MAOUSGRIHSMLLE-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.55 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |