C24H14F3N3OS — CID 2388075
2-(4-methylphenyl)-N-(4,5,6-trifluoro-1,3-benzothiazol-2-yl)quinoline-4-carboxamide (PubChem CID 2388075) has the molecular formula C24H14F3N3OS and a molecular weight of 449.46 g/mol. Its IUPAC name is 2-(4-methylphenyl)-N-(4,5,6-trifluoro-1,3-benzothiazol-2-yl)quinoline-4-carboxamide.
| Compound Name | 2-(4-methylphenyl)-N-(4,5,6-trifluoro-1,3-benzothiazol-2-yl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 2388075 |
| Molecular Formula | C24H14F3N3OS |
| Molecular Weight | 449.46 g/mol |
| Exact Mass | 449.08 |
| IUPAC Name | 2-(4-methylphenyl)-N-(4,5,6-trifluoro-1,3-benzothiazol-2-yl)quinoline-4-carboxamide |
| SMILES | Cc1ccc(-c2cc(C(=O)Nc3nc4c(F)c(F)c(F)cc4s3)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C24H14F3N3OS/c1-12-6-8-13(9-7-12)18-10-15(14-4-2-3-5-17(14)28-18)23(31)30-24-29-22-19(32-24)11-16(25)20(26)21(22)27/h2-11H,1H3,(H,29,30,31) |
| InChIKey | DJNMRUXUBUONFC-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.46 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|