C27H21N4O3S+ — CID 2321427
methyl 4-[[4-[4-(1,3-thiazol-2-ylcarbamoyl)quinolin-2-yl]pyridin-1-ium-1-yl]methyl]benzoate (PubChem CID 2321427) has the molecular formula C27H21N4O3S+ and a molecular weight of 481.56 g/mol. Its IUPAC name is methyl 4-[[4-[4-(1,3-thiazol-2-ylcarbamoyl)quinolin-2-yl]pyridin-1-ium-1-yl]methyl]benzoate.
| Compound Name | methyl 4-[[4-[4-(1,3-thiazol-2-ylcarbamoyl)quinolin-2-yl]pyridin-1-ium-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 2321427 |
| Molecular Formula | C27H21N4O3S+ |
| Molecular Weight | 481.56 g/mol |
| Exact Mass | 481.13 |
| IUPAC Name | methyl 4-[[4-[4-(1,3-thiazol-2-ylcarbamoyl)quinolin-2-yl]pyridin-1-ium-1-yl]methyl]benzoate |
| SMILES | COC(=O)c1ccc(C[n+]2ccc(-c3cc(C(=O)Nc4nccs4)c4ccccc4n3)cc2)cc1 |
| InChI | InChI=1S/C27H20N4O3S/c1-34-26(33)20-8-6-18(7-9-20)17-31-13-10-19(11-14-31)24-16-22(21-4-2-3-5-23(21)29-24)25(32)30-27-28-12-15-35-27/h2-16H,17H2,1H3/p+1 |
| InChIKey | HZGKEAGYUSCPJF-UHFFFAOYSA-O |
| XLogP | 4.73 |
| TPSA | 85.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.56 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|