C17H18FNO2 — CID 102706195
(4-fluoro-2-methylphenyl)methyl 5-amino-2,4-dimethylbenzoate (PubChem CID 102706195) has the molecular formula C17H18FNO2 and a molecular weight of 287.33 g/mol. Its IUPAC name is (4-fluoro-2-methylphenyl)methyl 5-amino-2,4-dimethylbenzoate.
| Compound Name | (4-fluoro-2-methylphenyl)methyl 5-amino-2,4-dimethylbenzoate |
|---|---|
| PubChem CID | 102706195 |
| Molecular Formula | C17H18FNO2 |
| Molecular Weight | 287.33 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | (4-fluoro-2-methylphenyl)methyl 5-amino-2,4-dimethylbenzoate |
| SMILES | Cc1cc(C)c(C(=O)OCc2ccc(F)cc2C)cc1N |
| InChI | InChI=1S/C17H18FNO2/c1-10-7-14(18)5-4-13(10)9-21-17(20)15-8-16(19)12(3)6-11(15)2/h4-8H,9,19H2,1-3H3 |
| InChIKey | CNJSQNPEQUHDNC-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.33 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|