C15H20FNO2 — CID 114341474
(4,4-dimethylcyclohexyl) 2-amino-4-fluorobenzoate (PubChem CID 114341474) has the molecular formula C15H20FNO2 and a molecular weight of 265.33 g/mol. Its IUPAC name is (4,4-dimethylcyclohexyl) 2-amino-4-fluorobenzoate.
| Compound Name | (4,4-dimethylcyclohexyl) 2-amino-4-fluorobenzoate |
|---|---|
| PubChem CID | 114341474 |
| Molecular Formula | C15H20FNO2 |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | (4,4-dimethylcyclohexyl) 2-amino-4-fluorobenzoate |
| SMILES | CC1(C)CCC(OC(=O)c2ccc(F)cc2N)CC1 |
| InChI | InChI=1S/C15H20FNO2/c1-15(2)7-5-11(6-8-15)19-14(18)12-4-3-10(16)9-13(12)17/h3-4,9,11H,5-8,17H2,1-2H3 |
| InChIKey | BFRFDHOMQGHRAJ-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|