C55H84N4O3 — CID 160862839
[4-(4-heptylcyclohexyl)cyclohexyl] 3,5-diaminobenzoate;4-[4-[4-(4-pentylcyclohexyl)cyclohexyl]phenoxy]benzene-1,3-diamine (PubChem CID 160862839) has the molecular formula C55H84N4O3 and a molecular weight of 849.30 g/mol. Its IUPAC name is [4-(4-heptylcyclohexyl)cyclohexyl] 3,5-diaminobenzoate;4-[4-[4-(4-pentylcyclohexyl)cyclohexyl]phenoxy]benzene-1,3-diamine.
| Compound Name | [4-(4-heptylcyclohexyl)cyclohexyl] 3,5-diaminobenzoate;4-[4-[4-(4-pentylcyclohexyl)cyclohexyl]phenoxy]benzene-1,3-diamine |
|---|---|
| PubChem CID | 160862839 |
| Molecular Formula | C55H84N4O3 |
| Molecular Weight | 849.30 g/mol |
| Exact Mass | 848.65 |
| IUPAC Name | [4-(4-heptylcyclohexyl)cyclohexyl] 3,5-diaminobenzoate;4-[4-[4-(4-pentylcyclohexyl)cyclohexyl]phenoxy]benzene-1,3-diamine |
| SMILES | CCCCCC1CCC(C2CCC(c3ccc(Oc4ccc(N)cc4N)cc3)CC2)CC1.CCCCCCCC1CCC(C2CCC(OC(=O)c3cc(N)cc(N)c3)CC2)CC1 |
| InChI | InChI=1S/C29H42N2O.C26H42N2O2/c1-2-3-4-5-21-6-8-22(9-7-21)23-10-12-24(13-11-23)25-14-17-27(18-15-25)32-29-19-16-26(30)20-28(29)31;1-2-3-4-5-6-7-19-8-10-20(11-9-19)21-12-14-25(15-13-21)30-26(29)22-16-23(27)18-24(28)17-22/h14-24H,2-13,30-31H2,1H3;16-21,25H,2-15,27-28H2,1H3 |
| InChIKey | SKSFRTPDVYZUMU-UHFFFAOYSA-N |
| XLogP | 15.04 |
| TPSA | 139.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 849.30 |
| LogP ≤ 5 | 15.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|