C22H23N3O3 — CID 21130029
[4-[(E)-3-amino-3-iminoprop-1-enyl]phenyl] 4-[ethyl(prop-2-enyl)carbamoyl]benzoate (PubChem CID 21130029) has the molecular formula C22H23N3O3 and a molecular weight of 377.44 g/mol. Its IUPAC name is [4-[(E)-3-amino-3-iminoprop-1-enyl]phenyl] 4-[ethyl(prop-2-enyl)carbamoyl]benzoate.
| Compound Name | [4-[(E)-3-amino-3-iminoprop-1-enyl]phenyl] 4-[ethyl(prop-2-enyl)carbamoyl]benzoate |
|---|---|
| PubChem CID | 21130029 |
| Molecular Formula | C22H23N3O3 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | [4-[(E)-3-amino-3-iminoprop-1-enyl]phenyl] 4-[ethyl(prop-2-enyl)carbamoyl]benzoate |
| SMILES | [H]/N=C(N)/C=C/c1ccc(OC(=O)c2ccc(C(=O)N(CC)CC=C)cc2)cc1 |
| InChI | InChI=1S/C22H23N3O3/c1-3-15-25(4-2)21(26)17-8-10-18(11-9-17)22(27)28-19-12-5-16(6-13-19)7-14-20(23)24/h3,5-14H,1,4,15H2,2H3,(H3,23,24)/b14-7+ |
| InChIKey | LEJXVFRKXYPGCN-VGOFMYFVSA-N |
| XLogP | 3.50 |
| TPSA | 96.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|