About (4-carbamimidoylphenyl) (E)-3-phenylprop-2-enoate
(4-carbamimidoylphenyl) (E)-3-phenylprop-2-enoate (PubChem CID 6438970) has the molecular formula C16H14N2O2
and a molecular weight of 266.30 g/mol. Its IUPAC name is (4-carbamimidoylphenyl) (E)-3-phenylprop-2-enoate.
Molecular Properties
| Compound Name | (4-carbamimidoylphenyl) (E)-3-phenylprop-2-enoate |
| PubChem CID | 6438970 |
| Molecular Formula | C16H14N2O2 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | (4-carbamimidoylphenyl) (E)-3-phenylprop-2-enoate |
| SMILES | [H]/N=C(\N)c1ccc(OC(=O)/C=C/c2ccccc2)cc1 |
| InChI | InChI=1S/C16H14N2O2/c17-16(18)13-7-9-14(10-8-13)20-15(19)11-6-12-4-2-1-3-5-12/h1-11H,(H3,17,18)/b11-6+ |
| InChIKey | SYMNKMKOTLVJCE-IZZDOVSWSA-N |
| XLogP | 2.59 |
| TPSA | 76.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (4-carbamimidoylphenyl) (E)-3-phenylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-carbamimidoylphenyl) (E)-3-phenylprop-2-enoate?
The IUPAC name of (4-carbamimidoylphenyl) (E)-3-phenylprop-2-enoate (CID 6438970) is (4-carbamimidoylphenyl) (E)-3-phenylprop-2-enoate.
What is the SMILES notation for (4-carbamimidoylphenyl) (E)-3-phenylprop-2-enoate?
The canonical SMILES for (4-carbamimidoylphenyl) (E)-3-phenylprop-2-enoate is [H]/N=C(\N)c1ccc(OC(=O)/C=C/c2ccccc2)cc1.
What is the InChIKey of (4-carbamimidoylphenyl) (E)-3-phenylprop-2-enoate?
The InChIKey is SYMNKMKOTLVJCE-IZZDOVSWSA-N. The full InChI is InChI=1S/C16H14N2O2/c17-16(18)13-7-9-14(10-8-13)20-15(19)11-6-12-4-2-1-3-5-12/h1-11H,(H3,17,18)/b11-6+.
What are the key properties of (4-carbamimidoylphenyl) (E)-3-phenylprop-2-enoate?
(4-carbamimidoylphenyl) (E)-3-phenylprop-2-enoate has a molecular weight of 266.30 g/mol, XLogP of 2.59, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-carbamimidoylphenyl) (E)-3-phenylprop-2-enoate is sourced from PubChem (CID 6438970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).