C21H31N3O8S2 — CID 13146265
(6-carbamimidoylnaphthalen-2-yl) 4-(aminomethyl)cyclohexane-1-carboxylate;methanesulfonic acid (PubChem CID 13146265) has the molecular formula C21H31N3O8S2 and a molecular weight of 517.63 g/mol. Its IUPAC name is (6-carbamimidoylnaphthalen-2-yl) 4-(aminomethyl)cyclohexane-1-carboxylate;methanesulfonic acid.
| Compound Name | (6-carbamimidoylnaphthalen-2-yl) 4-(aminomethyl)cyclohexane-1-carboxylate;methanesulfonic acid |
|---|---|
| PubChem CID | 13146265 |
| Molecular Formula | C21H31N3O8S2 |
| Molecular Weight | 517.63 g/mol |
| Exact Mass | 517.16 |
| IUPAC Name | (6-carbamimidoylnaphthalen-2-yl) 4-(aminomethyl)cyclohexane-1-carboxylate;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.CS(=O)(=O)O.[H]/N=C(\N)c1ccc2cc(OC(=O)C3CCC(CN)CC3)ccc2c1 |
| InChI | InChI=1S/C19H23N3O2.2CH4O3S/c20-11-12-1-3-13(4-2-12)19(23)24-17-8-7-14-9-16(18(21)22)6-5-15(14)10-17;2*1-5(2,3)4/h5-10,12-13H,1-4,11,20H2,(H3,21,22);2*1H3,(H,2,3,4) |
| InChIKey | HWHHWZLINVENAB-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 210.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.63 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|