C17H25Br2N3O4 — CID 18597681
methyl 2-[4-(aminomethyl)cyclohexanecarbonyl]oxy-5-carbamimidoylbenzoate;dihydrobromide (PubChem CID 18597681) has the molecular formula C17H25Br2N3O4 and a molecular weight of 495.21 g/mol. Its IUPAC name is methyl 2-[4-(aminomethyl)cyclohexanecarbonyl]oxy-5-carbamimidoylbenzoate;dihydrobromide.
| Compound Name | methyl 2-[4-(aminomethyl)cyclohexanecarbonyl]oxy-5-carbamimidoylbenzoate;dihydrobromide |
|---|---|
| PubChem CID | 18597681 |
| Molecular Formula | C17H25Br2N3O4 |
| Molecular Weight | 495.21 g/mol |
| Exact Mass | 493.02 |
| IUPAC Name | methyl 2-[4-(aminomethyl)cyclohexanecarbonyl]oxy-5-carbamimidoylbenzoate;dihydrobromide |
| SMILES | Br.Br.[H]/N=C(\N)c1ccc(OC(=O)C2CCC(CN)CC2)c(C(=O)OC)c1 |
| InChI | InChI=1S/C17H23N3O4.2BrH/c1-23-17(22)13-8-12(15(19)20)6-7-14(13)24-16(21)11-4-2-10(9-18)3-5-11;;/h6-8,10-11H,2-5,9,18H2,1H3,(H3,19,20);2*1H |
| InChIKey | OPWUYHVPNNITBV-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 128.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.21 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|