C40H79NO3S — CID 167680012
methane;(Z)-N-methylsulfonyl-2-[(Z)-octadec-9-enyl]icos-11-enamide (PubChem CID 167680012) has the molecular formula C40H79NO3S and a molecular weight of 654.14 g/mol. Its IUPAC name is methane;(Z)-N-methylsulfonyl-2-[(Z)-octadec-9-enyl]icos-11-enamide.
| Compound Name | methane;(Z)-N-methylsulfonyl-2-[(Z)-octadec-9-enyl]icos-11-enamide |
|---|---|
| PubChem CID | 167680012 |
| Molecular Formula | C40H79NO3S |
| Molecular Weight | 654.14 g/mol |
| Exact Mass | 653.58 |
| IUPAC Name | methane;(Z)-N-methylsulfonyl-2-[(Z)-octadec-9-enyl]icos-11-enamide |
| SMILES | C.CCCCCCCC/C=C\CCCCCCCCC(CCCCCCCC/C=C\CCCCCCCC)C(=O)NS(C)(=O)=O |
| InChI | InChI=1S/C39H75NO3S.CH4/c1-4-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-38(39(41)40-44(3,42)43)37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-5-2;/h18-21,38H,4-17,22-37H2,1-3H3,(H,40,41);1H4/b20-18-,21-19-; |
| InChIKey | VJVFUGXATHNLFB-YIQDKWKASA-N |
| XLogP | 13.17 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.14 |
| LogP ≤ 5 | 13.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|