C35H31ClN6O3 — CID 20635163
4-[1-[2-[(4-carbamimidoylphenyl)carbamoylamino]anilino]ethyl]-N-[4-(4-chlorophenoxy)phenyl]benzamide (PubChem CID 20635163) has the molecular formula C35H31ClN6O3 and a molecular weight of 619.13 g/mol. Its IUPAC name is 4-[1-[2-[(4-carbamimidoylphenyl)carbamoylamino]anilino]ethyl]-N-[4-(4-chlorophenoxy)phenyl]benzamide.
| Compound Name | 4-[1-[2-[(4-carbamimidoylphenyl)carbamoylamino]anilino]ethyl]-N-[4-(4-chlorophenoxy)phenyl]benzamide |
|---|---|
| PubChem CID | 20635163 |
| Molecular Formula | C35H31ClN6O3 |
| Molecular Weight | 619.13 g/mol |
| Exact Mass | 618.21 |
| IUPAC Name | 4-[1-[2-[(4-carbamimidoylphenyl)carbamoylamino]anilino]ethyl]-N-[4-(4-chlorophenoxy)phenyl]benzamide |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)Nc2ccccc2NC(C)c2ccc(C(=O)Nc3ccc(Oc4ccc(Cl)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C35H31ClN6O3/c1-22(39-31-4-2-3-5-32(31)42-35(44)41-28-14-10-24(11-15-28)33(37)38)23-6-8-25(9-7-23)34(43)40-27-16-20-30(21-17-27)45-29-18-12-26(36)13-19-29/h2-22,39H,1H3,(H3,37,38)(H,40,43)(H2,41,42,44) |
| InChIKey | WHRZKODACGKOCJ-UHFFFAOYSA-N |
| XLogP | 8.49 |
| TPSA | 141.36 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.13 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|