C29H28N6O4S — CID 20635174
methyl 4-[[4-[1-[2-[(4-carbamimidoylphenyl)carbamoylamino]anilino]ethyl]benzoyl]amino]thiophene-2-carboxylate (PubChem CID 20635174) has the molecular formula C29H28N6O4S and a molecular weight of 556.65 g/mol. Its IUPAC name is methyl 4-[[4-[1-[2-[(4-carbamimidoylphenyl)carbamoylamino]anilino]ethyl]benzoyl]amino]thiophene-2-carboxylate.
| Compound Name | methyl 4-[[4-[1-[2-[(4-carbamimidoylphenyl)carbamoylamino]anilino]ethyl]benzoyl]amino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 20635174 |
| Molecular Formula | C29H28N6O4S |
| Molecular Weight | 556.65 g/mol |
| Exact Mass | 556.19 |
| IUPAC Name | methyl 4-[[4-[1-[2-[(4-carbamimidoylphenyl)carbamoylamino]anilino]ethyl]benzoyl]amino]thiophene-2-carboxylate |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)Nc2ccccc2NC(C)c2ccc(C(=O)Nc3csc(C(=O)OC)c3)cc2)cc1 |
| InChI | InChI=1S/C29H28N6O4S/c1-17(18-7-9-20(10-8-18)27(36)33-22-15-25(40-16-22)28(37)39-2)32-23-5-3-4-6-24(23)35-29(38)34-21-13-11-19(12-14-21)26(30)31/h3-17,32H,1-2H3,(H3,30,31)(H,33,36)(H2,34,35,38) |
| InChIKey | ZZMCRVWDVZFQHC-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 158.43 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.65 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|