C28H29N5O — CID 143157199
N-(4-carbamimidoylphenyl)-3-(methylamino)-4,5-diphenyl-1-propan-2-ylpyrrole-2-carboxamide (PubChem CID 143157199) has the molecular formula C28H29N5O and a molecular weight of 451.57 g/mol. Its IUPAC name is N-(4-carbamimidoylphenyl)-3-(methylamino)-4,5-diphenyl-1-propan-2-ylpyrrole-2-carboxamide.
| Compound Name | N-(4-carbamimidoylphenyl)-3-(methylamino)-4,5-diphenyl-1-propan-2-ylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 143157199 |
| Molecular Formula | C28H29N5O |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.24 |
| IUPAC Name | N-(4-carbamimidoylphenyl)-3-(methylamino)-4,5-diphenyl-1-propan-2-ylpyrrole-2-carboxamide |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)c2c(NC)c(-c3ccccc3)c(-c3ccccc3)n2C(C)C)cc1 |
| InChI | InChI=1S/C28H29N5O/c1-18(2)33-25(20-12-8-5-9-13-20)23(19-10-6-4-7-11-19)24(31-3)26(33)28(34)32-22-16-14-21(15-17-22)27(29)30/h4-18,31H,1-3H3,(H3,29,30)(H,32,34) |
| InChIKey | VUEQGBCPCGALGI-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 95.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|