C35H39N7O5 — CID 11512950
4-[[2-[[2-acetamido-5-(diaminomethylideneamino)pentanoyl]amino]-4,5-diphenyl-1-propan-2-ylpyrrole-3-carbonyl]amino]benzoic acid (PubChem CID 11512950) has the molecular formula C35H39N7O5 and a molecular weight of 637.74 g/mol. Its IUPAC name is 4-[[2-[[2-acetamido-5-(diaminomethylideneamino)pentanoyl]amino]-4,5-diphenyl-1-propan-2-ylpyrrole-3-carbonyl]amino]benzoic acid.
| Compound Name | 4-[[2-[[2-acetamido-5-(diaminomethylideneamino)pentanoyl]amino]-4,5-diphenyl-1-propan-2-ylpyrrole-3-carbonyl]amino]benzoic acid |
|---|---|
| PubChem CID | 11512950 |
| Molecular Formula | C35H39N7O5 |
| Molecular Weight | 637.74 g/mol |
| Exact Mass | 637.30 |
| IUPAC Name | 4-[[2-[[2-acetamido-5-(diaminomethylideneamino)pentanoyl]amino]-4,5-diphenyl-1-propan-2-ylpyrrole-3-carbonyl]amino]benzoic acid |
| SMILES | CC(=O)NC(CCCN=C(N)N)C(=O)Nc1c(C(=O)Nc2ccc(C(=O)O)cc2)c(-c2ccccc2)c(-c2ccccc2)n1C(C)C |
| InChI | InChI=1S/C35H39N7O5/c1-21(2)42-30(24-13-8-5-9-14-24)28(23-11-6-4-7-12-23)29(33(45)40-26-18-16-25(17-19-26)34(46)47)31(42)41-32(44)27(39-22(3)43)15-10-20-38-35(36)37/h4-9,11-14,16-19,21,27H,10,15,20H2,1-3H3,(H,39,43)(H,40,45)(H,41,44)(H,46,47)(H4,36,37,38) |
| InChIKey | ZCVLGVGYKRUEPY-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 193.93 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.74 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|