C33H35N7O5 — CID 11570780
3-[[4-[[2-acetamido-5-(diaminomethylideneamino)pentanoyl]amino]-2-methyl-1,5-diphenylpyrrole-3-carbonyl]amino]benzoic acid (PubChem CID 11570780) has the molecular formula C33H35N7O5 and a molecular weight of 609.69 g/mol. Its IUPAC name is 3-[[4-[[2-acetamido-5-(diaminomethylideneamino)pentanoyl]amino]-2-methyl-1,5-diphenylpyrrole-3-carbonyl]amino]benzoic acid.
| Compound Name | 3-[[4-[[2-acetamido-5-(diaminomethylideneamino)pentanoyl]amino]-2-methyl-1,5-diphenylpyrrole-3-carbonyl]amino]benzoic acid |
|---|---|
| PubChem CID | 11570780 |
| Molecular Formula | C33H35N7O5 |
| Molecular Weight | 609.69 g/mol |
| Exact Mass | 609.27 |
| IUPAC Name | 3-[[4-[[2-acetamido-5-(diaminomethylideneamino)pentanoyl]amino]-2-methyl-1,5-diphenylpyrrole-3-carbonyl]amino]benzoic acid |
| SMILES | CC(=O)NC(CCCN=C(N)N)C(=O)Nc1c(C(=O)Nc2cccc(C(=O)O)c2)c(C)n(-c2ccccc2)c1-c1ccccc1 |
| InChI | InChI=1S/C33H35N7O5/c1-20-27(31(43)38-24-14-9-13-23(19-24)32(44)45)28(39-30(42)26(37-21(2)41)17-10-18-36-33(34)35)29(22-11-5-3-6-12-22)40(20)25-15-7-4-8-16-25/h3-9,11-16,19,26H,10,17-18H2,1-2H3,(H,37,41)(H,38,43)(H,39,42)(H,44,45)(H4,34,35,36) |
| InChIKey | PQJIVYHHOCCFDR-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 193.93 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.69 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|