C35H48N8O6 — CID 143157213
4-acetamido-5-[[3-[[1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]carbamoyl]-4,5-diphenyl-1-propan-2-ylpyrrol-2-yl]amino]-5-oxopentanoic acid;ethane (PubChem CID 143157213) has the molecular formula C35H48N8O6 and a molecular weight of 676.82 g/mol. Its IUPAC name is 4-acetamido-5-[[3-[[1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]carbamoyl]-4,5-diphenyl-1-propan-2-ylpyrrol-2-yl]amino]-5-oxopentanoic acid;ethane.
| Compound Name | 4-acetamido-5-[[3-[[1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]carbamoyl]-4,5-diphenyl-1-propan-2-ylpyrrol-2-yl]amino]-5-oxopentanoic acid;ethane |
|---|---|
| PubChem CID | 143157213 |
| Molecular Formula | C35H48N8O6 |
| Molecular Weight | 676.82 g/mol |
| Exact Mass | 676.37 |
| IUPAC Name | 4-acetamido-5-[[3-[[1-amino-5-(diaminomethylideneamino)-1-oxopentan-2-yl]carbamoyl]-4,5-diphenyl-1-propan-2-ylpyrrol-2-yl]amino]-5-oxopentanoic acid;ethane |
| SMILES | CC.CC(=O)NC(CCC(=O)O)C(=O)Nc1c(C(=O)NC(CCCN=C(N)N)C(N)=O)c(-c2ccccc2)c(-c2ccccc2)n1C(C)C |
| InChI | InChI=1S/C33H42N8O6.C2H6/c1-19(2)41-28(22-13-8-5-9-14-22)26(21-11-6-4-7-12-21)27(32(47)39-23(29(34)45)15-10-18-37-33(35)36)30(41)40-31(46)24(38-20(3)42)16-17-25(43)44;1-2/h4-9,11-14,19,23-24H,10,15-18H2,1-3H3,(H2,34,45)(H,38,42)(H,39,47)(H,40,46)(H,43,44)(H4,35,36,37);1-2H3 |
| InChIKey | HOWNGQWOGARZRV-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 237.02 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.82 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|