C32H39N7O6 — CID 143157227
4-[[3-[[2-acetamido-5-(aminomethylideneamino)pentanoyl]amino]-5-phenyl-1-propan-2-yl-4-pyridin-2-ylpyrrole-2-carbonyl]amino]-5-oxopentanoic acid (PubChem CID 143157227) has the molecular formula C32H39N7O6 and a molecular weight of 617.71 g/mol. Its IUPAC name is 4-[[3-[[2-acetamido-5-(aminomethylideneamino)pentanoyl]amino]-5-phenyl-1-propan-2-yl-4-pyridin-2-ylpyrrole-2-carbonyl]amino]-5-oxopentanoic acid.
| Compound Name | 4-[[3-[[2-acetamido-5-(aminomethylideneamino)pentanoyl]amino]-5-phenyl-1-propan-2-yl-4-pyridin-2-ylpyrrole-2-carbonyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 143157227 |
| Molecular Formula | C32H39N7O6 |
| Molecular Weight | 617.71 g/mol |
| Exact Mass | 617.30 |
| IUPAC Name | 4-[[3-[[2-acetamido-5-(aminomethylideneamino)pentanoyl]amino]-5-phenyl-1-propan-2-yl-4-pyridin-2-ylpyrrole-2-carbonyl]amino]-5-oxopentanoic acid |
| SMILES | CC(=O)NC(CCC/N=C/N)C(=O)Nc1c(-c2ccccn2)c(-c2ccccc2)n(C(C)C)c1C(=O)NC(C=O)CCC(=O)O |
| InChI | InChI=1S/C32H39N7O6/c1-20(2)39-29(22-10-5-4-6-11-22)27(24-12-7-8-17-35-24)28(30(39)32(45)37-23(18-40)14-15-26(42)43)38-31(44)25(36-21(3)41)13-9-16-34-19-33/h4-8,10-12,17-20,23,25H,9,13-16H2,1-3H3,(H2,33,34)(H,36,41)(H,37,45)(H,38,44)(H,42,43) |
| InChIKey | GQPLOLQHXMANGK-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 197.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.71 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|