C32H34N4O4 — CID 143157274
3-[[4-(5-aminopentanoylamino)-2,5-diphenyl-1-propan-2-ylpyrrole-3-carbonyl]amino]benzoic acid (PubChem CID 143157274) has the molecular formula C32H34N4O4 and a molecular weight of 538.65 g/mol. Its IUPAC name is 3-[[4-(5-aminopentanoylamino)-2,5-diphenyl-1-propan-2-ylpyrrole-3-carbonyl]amino]benzoic acid.
| Compound Name | 3-[[4-(5-aminopentanoylamino)-2,5-diphenyl-1-propan-2-ylpyrrole-3-carbonyl]amino]benzoic acid |
|---|---|
| PubChem CID | 143157274 |
| Molecular Formula | C32H34N4O4 |
| Molecular Weight | 538.65 g/mol |
| Exact Mass | 538.26 |
| IUPAC Name | 3-[[4-(5-aminopentanoylamino)-2,5-diphenyl-1-propan-2-ylpyrrole-3-carbonyl]amino]benzoic acid |
| SMILES | CC(C)n1c(-c2ccccc2)c(NC(=O)CCCCN)c(C(=O)Nc2cccc(C(=O)O)c2)c1-c1ccccc1 |
| InChI | InChI=1S/C32H34N4O4/c1-21(2)36-29(22-12-5-3-6-13-22)27(31(38)34-25-17-11-16-24(20-25)32(39)40)28(35-26(37)18-9-10-19-33)30(36)23-14-7-4-8-15-23/h3-8,11-17,20-21H,9-10,18-19,33H2,1-2H3,(H,34,38)(H,35,37)(H,39,40) |
| InChIKey | MRGYKWOBOMSGDI-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 126.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.65 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|