C35H41N7O4 — CID 143157259
3-[[4-[[2-acetamido-5-(diaminomethylideneamino)pentyl]amino]-2,5-diphenyl-1-propan-2-ylpyrrole-3-carbonyl]amino]benzoic acid (PubChem CID 143157259) has the molecular formula C35H41N7O4 and a molecular weight of 623.76 g/mol. Its IUPAC name is 3-[[4-[[2-acetamido-5-(diaminomethylideneamino)pentyl]amino]-2,5-diphenyl-1-propan-2-ylpyrrole-3-carbonyl]amino]benzoic acid.
| Compound Name | 3-[[4-[[2-acetamido-5-(diaminomethylideneamino)pentyl]amino]-2,5-diphenyl-1-propan-2-ylpyrrole-3-carbonyl]amino]benzoic acid |
|---|---|
| PubChem CID | 143157259 |
| Molecular Formula | C35H41N7O4 |
| Molecular Weight | 623.76 g/mol |
| Exact Mass | 623.32 |
| IUPAC Name | 3-[[4-[[2-acetamido-5-(diaminomethylideneamino)pentyl]amino]-2,5-diphenyl-1-propan-2-ylpyrrole-3-carbonyl]amino]benzoic acid |
| SMILES | CC(=O)NC(CCCN=C(N)N)CNc1c(C(=O)Nc2cccc(C(=O)O)c2)c(-c2ccccc2)n(C(C)C)c1-c1ccccc1 |
| InChI | InChI=1S/C35H41N7O4/c1-22(2)42-31(24-12-6-4-7-13-24)29(33(44)41-27-17-10-16-26(20-27)34(45)46)30(32(42)25-14-8-5-9-15-25)39-21-28(40-23(3)43)18-11-19-38-35(36)37/h4-10,12-17,20,22,28,39H,11,18-19,21H2,1-3H3,(H,40,43)(H,41,44)(H,45,46)(H4,36,37,38) |
| InChIKey | NUKMFQKMQIDGQV-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 176.86 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.76 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|