C30H29N5O4 — CID 11555467
5-[[4-[(4-carbamimidoylphenyl)carbamoyl]-5-methyl-1,2-diphenylpyrrol-3-yl]amino]-5-oxopentanoic acid (PubChem CID 11555467) has the molecular formula C30H29N5O4 and a molecular weight of 523.59 g/mol. Its IUPAC name is 5-[[4-[(4-carbamimidoylphenyl)carbamoyl]-5-methyl-1,2-diphenylpyrrol-3-yl]amino]-5-oxopentanoic acid.
| Compound Name | 5-[[4-[(4-carbamimidoylphenyl)carbamoyl]-5-methyl-1,2-diphenylpyrrol-3-yl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 11555467 |
| Molecular Formula | C30H29N5O4 |
| Molecular Weight | 523.59 g/mol |
| Exact Mass | 523.22 |
| IUPAC Name | 5-[[4-[(4-carbamimidoylphenyl)carbamoyl]-5-methyl-1,2-diphenylpyrrol-3-yl]amino]-5-oxopentanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)c2c(NC(=O)CCCC(=O)O)c(-c3ccccc3)n(-c3ccccc3)c2C)cc1 |
| InChI | InChI=1S/C30H29N5O4/c1-19-26(30(39)33-22-17-15-21(16-18-22)29(31)32)27(34-24(36)13-8-14-25(37)38)28(20-9-4-2-5-10-20)35(19)23-11-6-3-7-12-23/h2-7,9-12,15-18H,8,13-14H2,1H3,(H3,31,32)(H,33,39)(H,34,36)(H,37,38) |
| InChIKey | CXLAEZYOHDIFRM-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 150.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.59 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|