C21H33N5O4S — CID 59075490
1-[(3S)-3-(butylsulfonylamino)-4-hydroxybut-1-en-2-yl]-N-[(4-carbamimidoylphenyl)methyl]pyrrolidine-2-carboxamide (PubChem CID 59075490) has the molecular formula C21H33N5O4S and a molecular weight of 451.59 g/mol. Its IUPAC name is 1-[(3S)-3-(butylsulfonylamino)-4-hydroxybut-1-en-2-yl]-N-[(4-carbamimidoylphenyl)methyl]pyrrolidine-2-carboxamide.
| Compound Name | 1-[(3S)-3-(butylsulfonylamino)-4-hydroxybut-1-en-2-yl]-N-[(4-carbamimidoylphenyl)methyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 59075490 |
| Molecular Formula | C21H33N5O4S |
| Molecular Weight | 451.59 g/mol |
| Exact Mass | 451.23 |
| IUPAC Name | 1-[(3S)-3-(butylsulfonylamino)-4-hydroxybut-1-en-2-yl]-N-[(4-carbamimidoylphenyl)methyl]pyrrolidine-2-carboxamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)C2CCCN2C(=C)[C@@H](CO)NS(=O)(=O)CCCC)cc1 |
| InChI | InChI=1S/C21H33N5O4S/c1-3-4-12-31(29,30)25-18(14-27)15(2)26-11-5-6-19(26)21(28)24-13-16-7-9-17(10-8-16)20(22)23/h7-10,18-19,25,27H,2-6,11-14H2,1H3,(H3,22,23)(H,24,28)/t18-,19?/m1/s1 |
| InChIKey | PWIPCDGCXGPLDR-MRTLOADZSA-N |
| XLogP | 0.65 |
| TPSA | 148.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.59 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|