C25H25N3O5 — CID 54356074
(4R)-5-[5-(4-cyanophenyl)pent-4-ynylamino]-5-oxo-4-(phenylmethoxycarbonylamino)pentanoic acid (PubChem CID 54356074) has the molecular formula C25H25N3O5 and a molecular weight of 447.49 g/mol. Its IUPAC name is (4R)-5-[5-(4-cyanophenyl)pent-4-ynylamino]-5-oxo-4-(phenylmethoxycarbonylamino)pentanoic acid.
| Compound Name | (4R)-5-[5-(4-cyanophenyl)pent-4-ynylamino]-5-oxo-4-(phenylmethoxycarbonylamino)pentanoic acid |
|---|---|
| PubChem CID | 54356074 |
| Molecular Formula | C25H25N3O5 |
| Molecular Weight | 447.49 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | (4R)-5-[5-(4-cyanophenyl)pent-4-ynylamino]-5-oxo-4-(phenylmethoxycarbonylamino)pentanoic acid |
| SMILES | N#Cc1ccc(C#CCCCNC(=O)[C@@H](CCC(=O)O)NC(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C25H25N3O5/c26-17-20-12-10-19(11-13-20)7-5-2-6-16-27-24(31)22(14-15-23(29)30)28-25(32)33-18-21-8-3-1-4-9-21/h1,3-4,8-13,22H,2,6,14-16,18H2,(H,27,31)(H,28,32)(H,29,30)/t22-/m1/s1 |
| InChIKey | UJELFSRMBZTYSC-JOCHJYFZSA-N |
| XLogP | 2.97 |
| TPSA | 128.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.49 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|