C23H30O2 — CID 71098501
ethyl (4Z,7Z)-2-methyl-8-(3-methylspiro[5.5]undeca-1,4,7,10-tetraen-3-yl)octa-4,7-dienoate (PubChem CID 71098501) has the molecular formula C23H30O2 and a molecular weight of 338.49 g/mol. Its IUPAC name is ethyl (4Z,7Z)-2-methyl-8-(3-methylspiro[5.5]undeca-1,4,7,10-tetraen-3-yl)octa-4,7-dienoate.
| Compound Name | ethyl (4Z,7Z)-2-methyl-8-(3-methylspiro[5.5]undeca-1,4,7,10-tetraen-3-yl)octa-4,7-dienoate |
|---|---|
| PubChem CID | 71098501 |
| Molecular Formula | C23H30O2 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | ethyl (4Z,7Z)-2-methyl-8-(3-methylspiro[5.5]undeca-1,4,7,10-tetraen-3-yl)octa-4,7-dienoate |
| SMILES | CCOC(=O)C(C)C/C=C\C/C=C\C1(C)C=CC2(C=CCC=C2)C=C1 |
| InChI | InChI=1S/C23H30O2/c1-4-25-21(24)20(2)12-8-5-6-9-13-22(3)16-18-23(19-17-22)14-10-7-11-15-23/h5,8-11,13-20H,4,6-7,12H2,1-3H3/b8-5-,13-9- |
| InChIKey | SATGDOGSSFZSQH-GNMLYANXSA-N |
| XLogP | 5.71 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|