About 2-methylundec-4-enoyl 2-methylundec-4-enoate
2-methylundec-4-enoyl 2-methylundec-4-enoate (PubChem CID 175429820) has the molecular formula C24H42O3
and a molecular weight of 378.60 g/mol. Its IUPAC name is 2-methylundec-4-enoyl 2-methylundec-4-enoate.
Molecular Properties
| Compound Name | 2-methylundec-4-enoyl 2-methylundec-4-enoate |
| PubChem CID | 175429820 |
| Molecular Formula | C24H42O3 |
| Molecular Weight | 378.60 g/mol |
| Exact Mass | 378.31 |
| IUPAC Name | 2-methylundec-4-enoyl 2-methylundec-4-enoate |
| SMILES | CCCCCCC=CCC(C)C(=O)OC(=O)C(C)CC=CCCCCCC |
| InChI | InChI=1S/C24H42O3/c1-5-7-9-11-13-15-17-19-21(3)23(25)27-24(26)22(4)20-18-16-14-12-10-8-6-2/h15-18,21-22H,5-14,19-20H2,1-4H3 |
| InChIKey | YEYQSLYOPKDVSC-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 378.60 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-methylundec-4-enoyl 2-methylundec-4-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylundec-4-enoyl 2-methylundec-4-enoate?
The IUPAC name of 2-methylundec-4-enoyl 2-methylundec-4-enoate (CID 175429820) is 2-methylundec-4-enoyl 2-methylundec-4-enoate.
What is the SMILES notation for 2-methylundec-4-enoyl 2-methylundec-4-enoate?
The canonical SMILES for 2-methylundec-4-enoyl 2-methylundec-4-enoate is CCCCCCC=CCC(C)C(=O)OC(=O)C(C)CC=CCCCCCC.
What is the InChIKey of 2-methylundec-4-enoyl 2-methylundec-4-enoate?
The InChIKey is YEYQSLYOPKDVSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H42O3/c1-5-7-9-11-13-15-17-19-21(3)23(25)27-24(26)22(4)20-18-16-14-12-10-8-6-2/h15-18,21-22H,5-14,19-20H2,1-4H3.
What are the key properties of 2-methylundec-4-enoyl 2-methylundec-4-enoate?
2-methylundec-4-enoyl 2-methylundec-4-enoate has a molecular weight of 378.60 g/mol, XLogP of 7.16, 16 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylundec-4-enoyl 2-methylundec-4-enoate is sourced from PubChem (CID 175429820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).