C20H34O4S — CID 89110747
ethyl 2-[(3Z,6Z,9Z)-12-methyltrideca-3,6,9-trienyl]sulfonylbutanoate (PubChem CID 89110747) has the molecular formula C20H34O4S and a molecular weight of 370.56 g/mol. Its IUPAC name is ethyl 2-[(3Z,6Z,9Z)-12-methyltrideca-3,6,9-trienyl]sulfonylbutanoate.
| Compound Name | ethyl 2-[(3Z,6Z,9Z)-12-methyltrideca-3,6,9-trienyl]sulfonylbutanoate |
|---|---|
| PubChem CID | 89110747 |
| Molecular Formula | C20H34O4S |
| Molecular Weight | 370.56 g/mol |
| Exact Mass | 370.22 |
| IUPAC Name | ethyl 2-[(3Z,6Z,9Z)-12-methyltrideca-3,6,9-trienyl]sulfonylbutanoate |
| SMILES | CCOC(=O)C(CC)S(=O)(=O)CC/C=C\C/C=C\C/C=C\CC(C)C |
| InChI | InChI=1S/C20H34O4S/c1-5-19(20(21)24-6-2)25(22,23)17-15-13-11-9-7-8-10-12-14-16-18(3)4/h7-8,11-14,18-19H,5-6,9-10,15-17H2,1-4H3/b8-7-,13-11-,14-12- |
| InChIKey | IBMCRQGMCFBEJO-VMLWPGBOSA-N |
| XLogP | 4.63 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.56 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|