C23H39NO3 — CID 139609693
(11Z,14Z,17Z)-3-oxo-2-(propylamino)icosa-11,14,17-trienoic acid (PubChem CID 139609693) has the molecular formula C23H39NO3 and a molecular weight of 377.57 g/mol. Its IUPAC name is (11Z,14Z,17Z)-3-oxo-2-(propylamino)icosa-11,14,17-trienoic acid.
| Compound Name | (11Z,14Z,17Z)-3-oxo-2-(propylamino)icosa-11,14,17-trienoic acid |
|---|---|
| PubChem CID | 139609693 |
| Molecular Formula | C23H39NO3 |
| Molecular Weight | 377.57 g/mol |
| Exact Mass | 377.29 |
| IUPAC Name | (11Z,14Z,17Z)-3-oxo-2-(propylamino)icosa-11,14,17-trienoic acid |
| SMILES | CC/C=C\C/C=C\C/C=C\CCCCCCCC(=O)C(NCCC)C(=O)O |
| InChI | InChI=1S/C23H39NO3/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-21(25)22(23(26)27)24-20-4-2/h5-6,8-9,11-12,22,24H,3-4,7,10,13-20H2,1-2H3,(H,26,27)/b6-5-,9-8-,12-11- |
| InChIKey | JZYMHPXGFOSYPC-AGRJPVHOSA-N |
| XLogP | 5.60 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.57 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|