C11H8Cl3N3O3 — CID 3090152
N-[2,2,2-trichloro-1-(6-oxopyrimidin-1-yl)ethyl]furan-2-carboxamide (PubChem CID 3090152) has the molecular formula C11H8Cl3N3O3 and a molecular weight of 336.56 g/mol. Its IUPAC name is N-[2,2,2-trichloro-1-(6-oxopyrimidin-1-yl)ethyl]furan-2-carboxamide.
| Compound Name | N-[2,2,2-trichloro-1-(6-oxopyrimidin-1-yl)ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 3090152 |
| Molecular Formula | C11H8Cl3N3O3 |
| Molecular Weight | 336.56 g/mol |
| Exact Mass | 334.96 |
| IUPAC Name | N-[2,2,2-trichloro-1-(6-oxopyrimidin-1-yl)ethyl]furan-2-carboxamide |
| SMILES | O=C(NC(n1cnccc1=O)C(Cl)(Cl)Cl)c1ccco1 |
| InChI | InChI=1S/C11H8Cl3N3O3/c12-11(13,14)10(17-6-15-4-3-8(17)18)16-9(19)7-2-1-5-20-7/h1-6,10H,(H,16,19) |
| InChIKey | HDOIQTGWOCZTOW-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 77.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.56 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|