C17H14Cl5N3O2S — CID 3726397
[[2,2,2-trichloro-1-[(3,4-dichlorophenyl)carbamothioylamino]ethyl]amino] 2-phenylacetate (PubChem CID 3726397) has the molecular formula C17H14Cl5N3O2S and a molecular weight of 501.65 g/mol. Its IUPAC name is [[2,2,2-trichloro-1-[(3,4-dichlorophenyl)carbamothioylamino]ethyl]amino] 2-phenylacetate.
| Compound Name | [[2,2,2-trichloro-1-[(3,4-dichlorophenyl)carbamothioylamino]ethyl]amino] 2-phenylacetate |
|---|---|
| PubChem CID | 3726397 |
| Molecular Formula | C17H14Cl5N3O2S |
| Molecular Weight | 501.65 g/mol |
| Exact Mass | 498.92 |
| IUPAC Name | [[2,2,2-trichloro-1-[(3,4-dichlorophenyl)carbamothioylamino]ethyl]amino] 2-phenylacetate |
| SMILES | O=C(Cc1ccccc1)ONC(NC(=S)Nc1ccc(Cl)c(Cl)c1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C17H14Cl5N3O2S/c18-12-7-6-11(9-13(12)19)23-16(28)24-15(17(20,21)22)25-27-14(26)8-10-4-2-1-3-5-10/h1-7,9,15,25H,8H2,(H2,23,24,28) |
| InChIKey | NRCXYFCNSQIQRR-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.65 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|