C24H31N5O3 — CID 11224387
N-[(1S)-1-[(Z)-[(cyanoamino)-(2-methylanilino)methylidene]amino]-2,2-dimethylpropyl]-2-(3,4-dimethoxyphenyl)acetamide (PubChem CID 11224387) has the molecular formula C24H31N5O3 and a molecular weight of 437.54 g/mol. Its IUPAC name is N-[(1S)-1-[(Z)-[(cyanoamino)-(2-methylanilino)methylidene]amino]-2,2-dimethylpropyl]-2-(3,4-dimethoxyphenyl)acetamide.
| Compound Name | N-[(1S)-1-[(Z)-[(cyanoamino)-(2-methylanilino)methylidene]amino]-2,2-dimethylpropyl]-2-(3,4-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 11224387 |
| Molecular Formula | C24H31N5O3 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.24 |
| IUPAC Name | N-[(1S)-1-[(Z)-[(cyanoamino)-(2-methylanilino)methylidene]amino]-2,2-dimethylpropyl]-2-(3,4-dimethoxyphenyl)acetamide |
| SMILES | COc1ccc(CC(=O)N[C@@H](/N=C(\NC#N)Nc2ccccc2C)C(C)(C)C)cc1OC |
| InChI | InChI=1S/C24H31N5O3/c1-16-9-7-8-10-18(16)27-23(26-15-25)29-22(24(2,3)4)28-21(30)14-17-11-12-19(31-5)20(13-17)32-6/h7-13,22H,14H2,1-6H3,(H,28,30)(H2,26,27,29)/t22-/m0/s1 |
| InChIKey | UBYBLIILTZTSFV-QFIPXVFZSA-N |
| XLogP | 3.58 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|