C22H27ClN6O3 — CID 72773165
N-[1-[[[(2-chloro-3-pyridinyl)amino]-(cyanoamino)methylidene]amino]-2,2-dimethylpropyl]-2-(3,4-dimethoxyphenyl)acetamide (PubChem CID 72773165) has the molecular formula C22H27ClN6O3 and a molecular weight of 458.95 g/mol. Its IUPAC name is N-[1-[[[(2-chloro-3-pyridinyl)amino]-(cyanoamino)methylidene]amino]-2,2-dimethylpropyl]-2-(3,4-dimethoxyphenyl)acetamide.
| Compound Name | N-[1-[[[(2-chloro-3-pyridinyl)amino]-(cyanoamino)methylidene]amino]-2,2-dimethylpropyl]-2-(3,4-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 72773165 |
| Molecular Formula | C22H27ClN6O3 |
| Molecular Weight | 458.95 g/mol |
| Exact Mass | 458.18 |
| IUPAC Name | N-[1-[[[(2-chloro-3-pyridinyl)amino]-(cyanoamino)methylidene]amino]-2,2-dimethylpropyl]-2-(3,4-dimethoxyphenyl)acetamide |
| SMILES | COc1ccc(CC(=O)NC(N=C(NC#N)Nc2cccnc2Cl)C(C)(C)C)cc1OC |
| InChI | InChI=1S/C22H27ClN6O3/c1-22(2,3)20(29-21(26-13-24)27-15-7-6-10-25-19(15)23)28-18(30)12-14-8-9-16(31-4)17(11-14)32-5/h6-11,20H,12H2,1-5H3,(H,28,30)(H2,26,27,29) |
| InChIKey | MYZDFWNBQYQHDX-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 120.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.95 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|