C17H14Cl4N6O — CID 10115466
4-chloro-N-[2,2-dichloro-1-[(Z)-[[(2-chloro-3-pyridinyl)amino]-(cyanoamino)methylidene]amino]propyl]benzamide (PubChem CID 10115466) has the molecular formula C17H14Cl4N6O and a molecular weight of 460.15 g/mol. Its IUPAC name is 4-chloro-N-[2,2-dichloro-1-[(Z)-[[(2-chloro-3-pyridinyl)amino]-(cyanoamino)methylidene]amino]propyl]benzamide.
| Compound Name | 4-chloro-N-[2,2-dichloro-1-[(Z)-[[(2-chloro-3-pyridinyl)amino]-(cyanoamino)methylidene]amino]propyl]benzamide |
|---|---|
| PubChem CID | 10115466 |
| Molecular Formula | C17H14Cl4N6O |
| Molecular Weight | 460.15 g/mol |
| Exact Mass | 458.00 |
| IUPAC Name | 4-chloro-N-[2,2-dichloro-1-[(Z)-[[(2-chloro-3-pyridinyl)amino]-(cyanoamino)methylidene]amino]propyl]benzamide |
| SMILES | CC(Cl)(Cl)C(/N=C(\NC#N)Nc1cccnc1Cl)NC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H14Cl4N6O/c1-17(20,21)15(26-14(28)10-4-6-11(18)7-5-10)27-16(24-9-22)25-12-3-2-8-23-13(12)19/h2-8,15H,1H3,(H,26,28)(H2,24,25,27) |
| InChIKey | CYJNNAUMOWSXGY-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 102.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.15 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|