C20H21ClFN5O — CID 10135717
4-chloro-N-[1-[(Z)-[(cyanoamino)-(2-fluoroanilino)methylidene]amino]-2,2-dimethylpropyl]benzamide (PubChem CID 10135717) has the molecular formula C20H21ClFN5O and a molecular weight of 401.87 g/mol. Its IUPAC name is 4-chloro-N-[1-[(Z)-[(cyanoamino)-(2-fluoroanilino)methylidene]amino]-2,2-dimethylpropyl]benzamide.
| Compound Name | 4-chloro-N-[1-[(Z)-[(cyanoamino)-(2-fluoroanilino)methylidene]amino]-2,2-dimethylpropyl]benzamide |
|---|---|
| PubChem CID | 10135717 |
| Molecular Formula | C20H21ClFN5O |
| Molecular Weight | 401.87 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | 4-chloro-N-[1-[(Z)-[(cyanoamino)-(2-fluoroanilino)methylidene]amino]-2,2-dimethylpropyl]benzamide |
| SMILES | CC(C)(C)C(/N=C(\NC#N)Nc1ccccc1F)NC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H21ClFN5O/c1-20(2,3)18(26-17(28)13-8-10-14(21)11-9-13)27-19(24-12-23)25-16-7-5-4-6-15(16)22/h4-11,18H,1-3H3,(H,26,28)(H2,24,25,27) |
| InChIKey | BMMDXWONTSTGCW-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.87 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|