C22H26ClN5O — CID 23232552
2-(4-chlorophenyl)-N-[1-[(E)-[(cyanoamino)-(2-methylanilino)methylidene]amino]-2,2-dimethylpropyl]acetamide (PubChem CID 23232552) has the molecular formula C22H26ClN5O and a molecular weight of 411.94 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[1-[(E)-[(cyanoamino)-(2-methylanilino)methylidene]amino]-2,2-dimethylpropyl]acetamide.
| Compound Name | 2-(4-chlorophenyl)-N-[1-[(E)-[(cyanoamino)-(2-methylanilino)methylidene]amino]-2,2-dimethylpropyl]acetamide |
|---|---|
| PubChem CID | 23232552 |
| Molecular Formula | C22H26ClN5O |
| Molecular Weight | 411.94 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[1-[(E)-[(cyanoamino)-(2-methylanilino)methylidene]amino]-2,2-dimethylpropyl]acetamide |
| SMILES | Cc1ccccc1N/C(=N\C(NC(=O)Cc1ccc(Cl)cc1)C(C)(C)C)NC#N |
| InChI | InChI=1S/C22H26ClN5O/c1-15-7-5-6-8-18(15)26-21(25-14-24)28-20(22(2,3)4)27-19(29)13-16-9-11-17(23)12-10-16/h5-12,20H,13H2,1-4H3,(H,27,29)(H2,25,26,28) |
| InChIKey | DIGAKFCCTOUXSA-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.94 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|