C24H25ClN6O — CID 72773077
2-(4-chlorophenyl)-N-[1-[[(cyanoamino)-(isoquinolin-5-ylamino)methylidene]amino]-2,2-dimethylpropyl]acetamide (PubChem CID 72773077) has the molecular formula C24H25ClN6O and a molecular weight of 448.96 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[1-[[(cyanoamino)-(isoquinolin-5-ylamino)methylidene]amino]-2,2-dimethylpropyl]acetamide.
| Compound Name | 2-(4-chlorophenyl)-N-[1-[[(cyanoamino)-(isoquinolin-5-ylamino)methylidene]amino]-2,2-dimethylpropyl]acetamide |
|---|---|
| PubChem CID | 72773077 |
| Molecular Formula | C24H25ClN6O |
| Molecular Weight | 448.96 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[1-[[(cyanoamino)-(isoquinolin-5-ylamino)methylidene]amino]-2,2-dimethylpropyl]acetamide |
| SMILES | CC(C)(C)C(N=C(NC#N)Nc1cccc2cnccc12)NC(=O)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H25ClN6O/c1-24(2,3)22(30-21(32)13-16-7-9-18(25)10-8-16)31-23(28-15-26)29-20-6-4-5-17-14-27-12-11-19(17)20/h4-12,14,22H,13H2,1-3H3,(H,30,32)(H2,28,29,31) |
| InChIKey | USYNAOSFMJWXOF-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 102.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.96 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|