C18H15ClN2O — CID 29372808
3-(4-chlorophenyl)-N-isoquinolin-5-ylpropanamide (PubChem CID 29372808) has the molecular formula C18H15ClN2O and a molecular weight of 310.78 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-N-isoquinolin-5-ylpropanamide.
| Compound Name | 3-(4-chlorophenyl)-N-isoquinolin-5-ylpropanamide |
|---|---|
| PubChem CID | 29372808 |
| Molecular Formula | C18H15ClN2O |
| Molecular Weight | 310.78 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | 3-(4-chlorophenyl)-N-isoquinolin-5-ylpropanamide |
| SMILES | O=C(CCc1ccc(Cl)cc1)Nc1cccc2cnccc12 |
| InChI | InChI=1S/C18H15ClN2O/c19-15-7-4-13(5-8-15)6-9-18(22)21-17-3-1-2-14-12-20-11-10-16(14)17/h1-5,7-8,10-12H,6,9H2,(H,21,22) |
| InChIKey | QYRNGWCQDWNOSH-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.78 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |