C18H15Cl2N3O — CID 10406200
1-[2-(2,4-dichlorophenyl)ethyl]-3-isoquinolin-5-ylurea (PubChem CID 10406200) has the molecular formula C18H15Cl2N3O and a molecular weight of 360.24 g/mol. Its IUPAC name is 1-[2-(2,4-dichlorophenyl)ethyl]-3-isoquinolin-5-ylurea.
| Compound Name | 1-[2-(2,4-dichlorophenyl)ethyl]-3-isoquinolin-5-ylurea |
|---|---|
| PubChem CID | 10406200 |
| Molecular Formula | C18H15Cl2N3O |
| Molecular Weight | 360.24 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | 1-[2-(2,4-dichlorophenyl)ethyl]-3-isoquinolin-5-ylurea |
| SMILES | O=C(NCCc1ccc(Cl)cc1Cl)Nc1cccc2cnccc12 |
| InChI | InChI=1S/C18H15Cl2N3O/c19-14-5-4-12(16(20)10-14)6-9-22-18(24)23-17-3-1-2-13-11-21-8-7-15(13)17/h1-5,7-8,10-11H,6,9H2,(H2,22,23,24) |
| InChIKey | OCDTUKQPCVNPEG-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.24 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |