C22H19ClN4O2 — CID 69186040
1-[2-(3-azabicyclo[3.1.0]hexane-6-carbonyl)-5-chlorophenyl]-3-isoquinolin-5-ylurea (PubChem CID 69186040) has the molecular formula C22H19ClN4O2 and a molecular weight of 406.87 g/mol. Its IUPAC name is 1-[2-(3-azabicyclo[3.1.0]hexane-6-carbonyl)-5-chlorophenyl]-3-isoquinolin-5-ylurea.
| Compound Name | 1-[2-(3-azabicyclo[3.1.0]hexane-6-carbonyl)-5-chlorophenyl]-3-isoquinolin-5-ylurea |
|---|---|
| PubChem CID | 69186040 |
| Molecular Formula | C22H19ClN4O2 |
| Molecular Weight | 406.87 g/mol |
| Exact Mass | 406.12 |
| IUPAC Name | 1-[2-(3-azabicyclo[3.1.0]hexane-6-carbonyl)-5-chlorophenyl]-3-isoquinolin-5-ylurea |
| SMILES | O=C(Nc1cc(Cl)ccc1C(=O)C1C2CNCC21)Nc1cccc2cnccc12 |
| InChI | InChI=1S/C22H19ClN4O2/c23-13-4-5-15(21(28)20-16-10-25-11-17(16)20)19(8-13)27-22(29)26-18-3-1-2-12-9-24-7-6-14(12)18/h1-9,16-17,20,25H,10-11H2,(H2,26,27,29) |
| InChIKey | YLCUIGKYNKSZAW-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.87 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |