C24H24ClN5O — CID 11510327
2-(4-chlorophenyl)-N-[1-[(Z)-[(cyanoamino)-quinolin-5-ylmethylidene]amino]-2,2-dimethylpropyl]acetamide (PubChem CID 11510327) has the molecular formula C24H24ClN5O and a molecular weight of 433.94 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[1-[(Z)-[(cyanoamino)-quinolin-5-ylmethylidene]amino]-2,2-dimethylpropyl]acetamide.
| Compound Name | 2-(4-chlorophenyl)-N-[1-[(Z)-[(cyanoamino)-quinolin-5-ylmethylidene]amino]-2,2-dimethylpropyl]acetamide |
|---|---|
| PubChem CID | 11510327 |
| Molecular Formula | C24H24ClN5O |
| Molecular Weight | 433.94 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[1-[(Z)-[(cyanoamino)-quinolin-5-ylmethylidene]amino]-2,2-dimethylpropyl]acetamide |
| SMILES | CC(C)(C)C(/N=C(\NC#N)c1cccc2ncccc12)NC(=O)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H24ClN5O/c1-24(2,3)23(29-21(31)14-16-9-11-17(25)12-10-16)30-22(28-15-26)19-6-4-8-20-18(19)7-5-13-27-20/h4-13,23H,14H2,1-3H3,(H,28,30)(H,29,31) |
| InChIKey | ZOEPQZKRTOOSEB-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 90.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.94 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|